For research use only. Not for therapeutic Use.
Phenmetrazine-d5 Hydrochloride is a deuterated form of phenmetrazine, a stimulant drug that was previously used as an appetite suppressant. In this version, five hydrogen atoms are replaced with deuterium, which allows for precise tracking in pharmacokinetic and metabolic studies using mass spectrometry. The hydrochloride salt form increases its solubility and stability. Phenmetrazine-d5 is valuable in research for understanding the drug’s absorption, distribution, metabolism, and excretion, as well as for investigating its potential effects and interactions in biological systems.
| CAS Number | 1246817-91-3 |
| Synonyms | Phenmetrazine-d5 Hydrochloride |
| Molecular Formula | C11H16ClNO |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)morpholine;hydrochloride |
| InChI | InChI=1S/C11H15NO.ClH/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10;/h2-6,9,11-12H,7-8H2,1H3;1H/i2D,3D,4D,5D,6D; |
| InChIKey | VJNXVAVKCZJOFQ-CERKJNTMSA-N |
| SMILES | CC1C(OCCN1)C2=CC=CC=C2.Cl |
