For research use only. Not for therapeutic Use.
Phenol, 4-ethynyl-（Cat No.:M048010）, also known as p-ethynyl phenol, is a specialized organic compound characterized by the presence of an ethynyl group (—C≡CH) directly attached to the para position of a phenol ring. This structural configuration gives it unique properties and reactivities compared to other phenols. It is often utilized in polymer chemistry and materials science, particularly in the synthesis of advanced polymer structures where its ethynyl group can undergo polymerization reactions, forming rigid, heat-resistant polymers.
| Catalog Number | M048010 |
| CAS Number | 2200-91-1 |
| Molecular Formula | C8H6O |
| Purity | ≥95% |
| IUPAC Name | 4-ethynylphenol |
| InChI | InChI=1S/C8H6O/c1-2-7-3-5-8(9)6-4-7/h1,3-6,9H |
| InChIKey | HLXJEKPLQLVJGK-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)O |
