Phenol-d6 is a fully deuterated version of phenol, featuring six deuterium atoms. This compound is widely used as an internal standard in NMR spectroscopy and mass spectrometry, providing precise and accurate data in analytical studies. Phenol-d6 is essential for research in organic chemistry, environmental science, and pharmaceuticals, where it aids in the study of reaction mechanisms, metabolic pathways, and the behavior of phenolic compounds. Its stable isotope labeling ensures consistency across experiments, making it a valuable resource for scientists conducting high-precision research in various chemical and biochemical applications.
| Catalog Number | M061731 |
| CAS Number | 13127-88-3 |
| Molecular Formula | C6H6O |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-deuteriooxybenzene |
| InChI | InChI=1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,2D,3D,4D,5D/hD |
| InChIKey | ISWSIDIOOBJBQZ-QNKSCLMFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])O[2H])[2H])[2H] |
