For research use only. Not for therapeutic Use.
Phenoldisulfonic acid（Cat No.:M011640）, is a strong aromatic sulfonic acid. It is a white to pale yellow solid that is highly soluble in water. This compound is widely used in the chemical industry as a powerful sulfonating agent and a key intermediate in the synthesis of various organic compounds. Phenoldisulfonic acid is employed in the production of dyes, pigments, and phenolic resins, where it plays a crucial role in introducing sulfonic acid groups to enhance solubility and reactivity.
| Catalog Number | M011640 |
| CAS Number | 96-77-5 |
| Synonyms | 3-Benzenedisulfonicacid,4-hydroxy-1;4-hydroxy-3-benzenedisulfonicacid;4-Hydroxybenzenedisulfonicacid;Phenol-2,4-disulfonicacid;PHENOLDISULFONIC ACID;Phenol disulfonic acid solution;PHENOLDISULPHONIC ACID;4-hydroxybenzene-1,3-disulphonic acid |
| Molecular Formula | C6H6O7S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-hydroxybenzene-1,3-disulfonic acid |
| InChI | InChI=1S/C6H6O7S2/c7-5-2-1-4(14(8,9)10)3-6(5)15(11,12)13/h1-3,7H,(H,8,9,10)(H,11,12,13) |
| InChIKey | JXBUOZMYKQDZFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)O |
| Reference | 1: Sung FC. Study of modification of the phenoldisulfonic acid method for the 2: Fisher GE, Huls TA. A comparison of phenoldisulfonic acid, nondispersive |
