For research use only. Not for therapeutic Use.
Phenothiazine(Cat No.:A000176) is a heterocyclic compound with various applications in medicine and other fields. Its action target involves interactions with neurotransmitters and receptors in the central nervous system. The mode of action includes blocking dopamine receptors, leading to its use as an antipsychotic medication. Pharmacologically, Phenothiazine is utilized as an antipsychotic agent in the treatment of schizophrenia and other psychiatric disorders. It also exhibits antiemetic properties, making it effective in managing nausea and vomiting. Additionally, Phenothiazine has been employed as a dye in the textile industry and as an intermediate in the synthesis of other compounds.
Catalog Number | A000176 |
CAS Number | 92-84-2 |
Synonyms | ENT 38 |
Molecular Formula | C12H9NS |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | 10H-phenothiazine |
InChI | InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
InChIKey | WJFKNYWRSNBZNX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC3=CC=CC=C3S2 |