For research use only. Not for therapeutic Use.
Phenoxyacetic acid-d5(Cat No.:R010440)is a deuterated derivative of phenoxyacetic acid, where five hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This modification is primarily used in NMR (Nuclear Magnetic Resonance) spectroscopy to enhance the clarity of spectral data by reducing the interference from protons. Phenoxyacetic acid-d5 is valuable in chemical research, particularly in studying the molecular structure and dynamics of organic compounds. It is used in applications like the synthesis of herbicides, pharmaceuticals, and in isotopic labeling studies, providing insights into chemical reactions and mechanisms in various fields.
CAS Number | 154492-74-7 |
Synonyms | 2-(2,3,4,5,6-pentadeuteriophenoxy)acetic acid |
Molecular Formula | C8H3D5O3 |
Purity | ≥95% |
IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenoxy)acetic acid |
InChI | InChI=1S/C8H8O3/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/i1D,2D,3D,4D,5D |
InChIKey | LCPDWSOZIOUXRV-RALIUCGRSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OCC(=O)O)[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |