For research use only. Not for therapeutic Use.
Phentolamine mesylate(CAT: I004463) is a nonselective alpha-adrenergic antagonist. It works by blocking the alpha-adrenergic receptors, which are responsible for the constriction of blood vessels. By blocking these receptors, phentolamine mesylate causes relaxation of the smooth muscles in blood vessel walls, leading to vasodilation and increased blood flow. It is primarily used in the management of conditions such as hypertension, pheochromocytoma (a tumor of the adrenal gland), and certain types of erectile dysfunction.
| Catalog Number | I004463 |
| CAS Number | 65-28-1 |
| Synonyms | 3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol;methanesulfonic acid |
| Molecular Formula | C17H19N3O • CH3SO3H |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO 75 mg/mL; Water 75 mg/mL |
| Storage | 3 years -20C powder |
| Overview of Clinical Research | <span style=”color:#000000;”><span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>Phentolamine Mesylate is an a<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>lpha adrenergic receptor antagonist developed by </span><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Novalar Pharmaceuticals.</span></span></span></span> |
| IUPAC Name | 3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol;methanesulfonic acid |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC(=CC=C3)O.CS(=O)(=O)O |
| Reference | <br /> |
