For research use only. Not for therapeutic Use.
Phenyl naphthalene-2-sulfonate (Cat.No:L004171) is a significant chemical compound utilized in various industrial applications. Its structure, combining a phenyl group with a naphthalene-2-sulfonate moiety, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized materials and pharmaceuticals.
CAS Number | 62141-80-4 |
Molecular Formula | C16H12O3S |
Purity | ≥95% |
IUPAC Name | phenyl naphthalene-2-sulfonate |
InChI | InChI=1S/C16H12O3S/c17-20(18,19-15-8-2-1-3-9-15)16-11-10-13-6-4-5-7-14(13)12-16/h1-12H |
InChIKey | AMZOVRCWZOIZHH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OS(=O)(=O)C2=CC3=CC=CC=C3C=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |