For research use only. Not for therapeutic Use.
Phenyl valerate（Cat No.:R069785）, is an organic compound belonging to the class of esters. It is composed of a valeric acid molecule (a five-carbon carboxylic acid) and a phenyl group. This compound is commonly used as a flavoring agent and fragrance ingredient, imparting sweet and fruity notes to various food products, perfumes, and cosmetics. It contributes to the overall aroma and taste profile of these items.
| Catalog Number | R069785 |
| CAS Number | 20115-23-5 |
| Molecular Formula | C11H14O2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | phenyl pentanoate |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-11(12)13-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | MVIMPQVBUPCHEV-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)OC1=CC=CC=C1 |
