For research use only. Not for therapeutic Use.
Phenylalanylalanine(CAT: I015101) is a dipeptide composed of the amino acids phenylalanine and alanine linked by a peptide bond. It serves as a valuable compound in biochemical and proteomics research for studying peptide metabolism, enzymatic activity, and protein-protein interactions. Due to its structure, Phenylalanylalanine is often used to investigate peptide transport mechanisms and substrate specificity of proteolytic enzymes like peptidases and proteases. Additionally, it can be utilized in the synthesis of more complex peptides, aiding in the development of peptide-based drugs and in exploring protein folding and structural dynamics in molecular biology.
CAS Number | 3918-87-4 |
Molecular Formula | C₁₂H₁₆N₂O₃ |
Purity | ≥95% |
Target | Disease Research Fields |
IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoic acid |
InChI | InChI=1S/C12H16N2O3/c1-8(12(16)17)14-11(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
InChIKey | MIDZLCFIAINOQN-WPRPVWTQSA-N |
SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |