For research use only. Not for therapeutic Use.
Phenylalanylleucine（Cat No.:I014570）is a compound that combines the amino acids phenylalanine and leucine. Both are essential amino acids, meaning they must be obtained from the diet as the body cannot synthesize them. Phenylalanine is a precursor to important neurotransmitters like dopamine, while leucine plays a key role in protein synthesis and muscle repair. When these amino acids are linked together, they form a dipeptide, which can have various biochemical functions in metabolism, protein structure, and cellular processes, depending on its context in biological systems or synthetic applications.
| Catalog Number | I014570 |
| CAS Number | 3303-55-7 |
| Synonyms | Phenylalanylleucine; L-Phenylalanyl-L-leucine; Phe-leu;;L-phenylalanyl-L-leucine |
| Molecular Formula | C15H22N2O3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)8-13(15(19)20)17-14(18)12(16)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | RFCVXVPWSPOMFJ-STQMWFEESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N |
