For research use only. Not for therapeutic Use.
Phenylalanyltrypotophan(Cat No.:L007014), also known as Phe-Trp, is a dipeptide consisting of the amino acids phenylalanine (Phe) and tryptophan (Trp). This dipeptide plays a vital role in biochemical and biological processes, contributing to protein structure and function. Phenylalanine is an essential amino acid involved in protein synthesis, while tryptophan is also essential and serves as a precursor for serotonin and melatonin.
CAS Number | 24587-41-5 |
Molecular Formula | C20H21N3O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C20H21N3O3/c21-16(10-13-6-2-1-3-7-13)19(24)23-18(20(25)26)11-14-12-22-17-9-5-4-8-15(14)17/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 |
InChIKey | JMCOUWKXLXDERB-WMZOPIPTSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)O)N |