For research use only. Not for therapeutic Use.
Semapimod HCl (Cat No.: R005973) is a selective inhibitor of the enzyme sphingosine kinase 1 (SK1), which is involved in the production of sphingosine-1-phosphate (S1P), a bioactive lipid signaling molecule. By inhibiting SK1, Semapimod reduces S1P levels, impacting various cellular processes such as immune cell migration, inflammation, and cancer cell proliferation. It has been studied for its potential to treat conditions like autoimmune diseases, cancer, and inflammation. Ongoing research aims to evaluate its therapeutic efficacy and safety in clinical settings.
| CAS Number | 64984-31-2 |
| Synonyms | Phenyl-ethynesulfonic Acid Amide; Pifithrin-υ; PFTυ; |
| Molecular Formula | C8H7NO2S |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at 4°C |
| IUPAC Name | 2-phenylethynesulfonamide |
| InChI | InChI=1S/C8H7NO2S/c9-12(10,11)7-6-8-4-2-1-3-5-8/h1-5H,(H2,9,10,11) |
| InChIKey | ZZUZYEMRHCMVTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CS(=O)(=O)N |
