For research use only. Not for therapeutic Use.
Phenylglyoxylic Acid-d5 is a deuterated version of phenylglyoxylic acid, with five hydrogen atoms replaced by deuterium. This compound is primarily used in metabolic and pharmacokinetic studies, where the deuterium labeling facilitates the tracking and differentiation of the compound in complex biological systems through mass spectrometry. Phenylglyoxylic acid is a key intermediate in the metabolism of styrene and other aromatic compounds, making it significant in toxicology and environmental research. It is also utilized in organic synthesis and material chemistry for the development and study of new chemical reactions and pathways.
CAS Number | 1217089-53-6 |
Synonyms | α-Oxobenzeneacetic Acid-d5; 2-Oxo-2-(phenyl-d5)acetic Acid; 2-Oxo-2-(phenyl-d5)ethanoic Acid; Benzoylformic Acid-d5; α-Ketophenylacetic Acid-d5; NSC 28293-d5; |
Molecular Formula | C8H6O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
InChI | InChI=1S/C8H6O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5H,(H,10,11)/i1D,2D,3D,4D,5D |
InChIKey | FAQJJMHZNSSFSM-RALIUCGRSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C(=O)O)[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |