For research use only. Not for therapeutic Use.
Phenylpropionyl-coenzyme A (Cat No.:M026335) is a biochemical derivative formed when phenylpropionic acid is conjugated with coenzyme A (CoA). This reaction is crucial in the metabolic pathway for the catabolism of various aromatic amino acids like phenylalanine. Phenylpropionyl-CoA plays a key role in the beta-oxidation process of aromatic fatty acids, where it undergoes enzymatic reactions that break it down into smaller molecules, ultimately contributing to energy production in cells. Its study is important in understanding metabolic disorders and could be relevant in developing therapies for diseases related to amino acid metabolism.
CAS Number | 117411-09-3 |
Synonyms | phenylpropionyl-coenzyme A |
Molecular Formula | C30H44N7O17P3S |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-phenylpropanethioate |
InChI | InChI=1S/C30H44N7O17P3S/c1-30(2,25(41)28(42)33-11-10-20(38)32-12-13-58-21(39)9-8-18-6-4-3-5-7-18)15-51-57(48,49)54-56(46,47)50-14-19-24(53-55(43,44)45)23(40)29(52-19)37-17-36-22-26(31)34-16-35-27(22)37/h3-7,16-17,19,23-25,29,40-41H,8-15H2,1-2H3,(H,32,38)(H,33,42)(H,46,47)(H,48,49)(H2,31,34,35)(H2,43,44,45)/t19-,23-,24-,25+,29-/m1/s1 |
InChIKey | HYSDRCZPYSOWME-FUEUKBNZSA-N |
SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)CCC4=CC=CC=C4)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |