For research use only. Not for therapeutic Use.
Phenyltrimethoxysilane (Cat.No:R070881) is a silane coupling agent used to enhance adhesion between organic materials and inorganic surfaces. It contains a phenyl group and three methoxy groups attached to a silicon atom. This compound is commonly employed in the formulation of coatings, adhesives, and sealants to improve bonding on various substrates
| Catalog Number | R070881 |
| CAS Number | 2996-92-1 |
| Molecular Formula | C9H14O3Si |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | trimethoxy(phenyl)silane |
| InChI | InChI=1S/C9H14O3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=CC=CC=C1)(OC)OC |
