For research use only. Not for therapeutic Use.
Phloracetophenone（Cat No.:R009105）, also known as 2′,4′,6′-trihydroxyacetophenone, is a naturally occurring phenolic compound found in various plants. It is valued for its antioxidant and anti-inflammatory properties, making it a subject of interest in medicinal chemistry and pharmaceutical research. Phloracetophenone has shown potential in inhibiting oxidative stress and modulating inflammatory pathways, which can be beneficial in conditions like arthritis and neurodegenerative diseases. Additionally, it serves as a chemical intermediate in the synthesis of more complex molecules, making it useful in organic synthesis and various industrial applications.
| Catalog Number | R009105 |
| CAS Number | 480-66-0 |
| Synonyms | 1-(2,4,6-Trihydroxyphenyl)-ethanone; 2’,4’,6’-Trihydroxyacetophenone; ?Phloroacetophenone; 2-Acetyl-1,3,5-trihydroxybenzene; Acetophloroglucine; Acetylphloroglucinol; NSC 54927; Phloracetophene |
| Molecular Formula | C8H8O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(2,4,6-trihydroxyphenyl)ethanone |
| InChI | InChI=1S/C8H8O4/c1-4(9)8-6(11)2-5(10)3-7(8)12/h2-3,10-12H,1H3 |
| InChIKey | XLEYFDVVXLMULC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1O)O)O |
| Reference | Liquid chromatographic assay of microbially derived phloroglucinol antibiotics for establishing the biosynthetic route to production, and the factors affecting their regulation. Shanahan P. & Glennon J.D. Anal. Chim. Acta 1993, 272, 271.<br/><br/>Role of 2,4-diacetylphloroglucinol in the interactions of the biocontrol Pseudomonad strain F113 with the potato cyst nematode Globodera rostochiensis. Cronin D. et al. Appl. Environ. Microbiol. 1997, 63, 1357.<br/><br/>Suppression of root diseases by Pseudomonas fluorescens CHA0: importance of the bacterial secondary metabolite 2,4-diacetylphloroglucinol. Keel C. et al. Molec. Plant-Microbe Interact. 1992, 5, 4.</span></p> |
