For research use only. Not for therapeutic Use.
Phosmidosine(Cat No.:M107425) is a synthetic nucleoside analog that incorporates a phosphoramidate group. This compound is designed to mimic natural nucleosides but with modifications that can enhance its stability and efficacy in biological systems. Phosmidosine is primarily researched for its potential applications in antiviral and anticancer therapies, as it can interfere with nucleic acid synthesis within cells. Its mechanism typically involves being incorporated into the growing DNA or RNA strand during replication, leading to the termination of the process or the introduction of mutations, which can inhibit the proliferation of viruses or cancerous cells.
CAS Number | 134966-01-1 |
Molecular Formula | C16H24N7O8P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-N-[[(2R,3S,4R,5R)-5-(6-amino-8-oxo-7H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]pyrrolidine-2-carboxamide |
InChI | InChI=1S/C16H24N7O8P/c1-29-32(28,22-14(26)7-3-2-4-18-7)30-5-8-10(24)11(25)15(31-8)23-13-9(21-16(23)27)12(17)19-6-20-13/h6-8,10-11,15,18,24-25H,2-5H2,1H3,(H,21,27)(H2,17,19,20)(H,22,26,28)/t7-,8+,10+,11+,15+,32?/m0/s1 |
InChIKey | HBJDRXMCLFRSGN-CRDJCKMPSA-N |
SMILES | COP(=O)(NC(=O)C1CCCN1)OCC2C(C(C(O2)N3C4=NC=NC(=C4NC3=O)N)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |