For research use only. Not for therapeutic Use.
Phospho-L-arginine is a phosphorylated amino acid derivative crucial for advanced biochemical and pharmaceutical research. This compound is instrumental in studying protein phosphorylation, cellular signaling pathways, and enzyme regulation. Its unique properties enable detailed analysis of phosphorylation mechanisms and interactions within biological systems. Phospho-L-arginine offers exceptional purity and stability, making it an essential tool for developing targeted therapies and exploring cellular processes at the molecular level, thus advancing scientific understanding and therapeutic innovations.
CAS Number | 1189-11-3 |
Synonyms | N5-[Imino(phosphonoamine)methyl-L-ornithine Trisodium Salt; L-Arginine-NG-phosphoric Acid Trisodium Salt; Phosphoarginine A Trisodium Salt; |
Molecular Formula | C6H15N4O5P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-5-[[amino-(phosphonoamino)methylidene]amino]pentanoic acid |
InChI | InChI=1S/C6H15N4O5P/c7-4(5(11)12)2-1-3-9-6(8)10-16(13,14)15/h4H,1-3,7H2,(H,11,12)(H5,8,9,10,13,14,15)/t4-/m0/s1 |
InChIKey | CCTIOCVIZPCTGO-BYPYZUCNSA-N |
SMILES | C(CC(C(=O)O)N)CN=C(N)NP(=O)(O)O |