For research use only. Not for therapeutic Use.
Phosphoric acid ethyldisodium salt (Cat.No:M088221) is a sodium salt of phosphoric acid, often used in various industrial applications. It serves as a buffering agent, pH regulator, and corrosion inhibitor. Additionally, it finds uses in food processing and as a component in some cleaning agents.
CAS Number | 17323-83-0 |
Synonyms | Phosphoric acid ethyldisodium salt |
Molecular Formula | C2H5Na2O4P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | disodium;ethyl phosphate |
InChI | InChI=1S/C2H7O4P.2Na/c1-2-6-7(3,4)5;;/h2H2,1H3,(H2,3,4,5);;/q;2*+1/p-2 |
InChIKey | ANLFRXGAWNYDEJ-UHFFFAOYSA-L |
SMILES | CCOP(=O)([O-])[O-].[Na+].[Na+] |