For research use only. Not for therapeutic Use.
Phosphoric Acid Tris(2-methylpropyl) Ester (Cat No.: R015084) is an organophosphate compound used in industrial and chemical research. It serves as a plasticizer, flame retardant, and additive in various applications. This compound is essential for studying material properties, enhancing product performance, and developing advanced formulations, ensuring precise and reliable results in research and industrial processes.
| CAS Number | 126-71-6 |
| Synonyms | Isobutyl Phosphate; Phosphoric Acid Triisobutyl Ester; Antifoam TIP; Daiguard 400; NSC 62222; Reomol TIBP; Triisobutyl Phosphate |
| Molecular Formula | C12H27O4P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tris(2-methylpropyl) phosphate |
| InChI | InChI=1S/C12H27O4P/c1-10(2)7-14-17(13,15-8-11(3)4)16-9-12(5)6/h10-12H,7-9H2,1-6H3 |
| InChIKey | HRKAMJBPFPHCSD-UHFFFAOYSA-N |
| SMILES | CC(C)COP(=O)(OCC(C)C)OCC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
