For research use only. Not for therapeutic Use.
Phosphorylethanolamine-d₄(CAT: R058229) is a deuterium-labeled analog of phosphorylethanolamine, a key phospholipid precursor involved in cell membrane biosynthesis and lipid metabolism. The incorporation of deuterium enhances its utility in metabolic and lipidomics research, enabling precise tracking in mass spectrometry-based studies. Phosphorylethanolamine-d₄ is widely used in studying phospholipid pathways, neurodegenerative diseases, and biomarker discovery. Its stable isotope labeling makes it an essential tool for investigating cellular signaling, membrane dynamics, and metabolic flux in various biological and pharmaceutical research applications.
| CAS Number | 1169692-38-9 |
| Synonyms | (2-amino-1,1,2,2-tetradeuterioethyl) dihydrogen phosphate |
| Molecular Formula | C2H4D4NO4P |
| Purity | ≥95% |
| IUPAC Name | (2-amino-1,1,2,2-tetradeuterioethyl) dihydrogen phosphate |
| InChI | InChI=1S/C2H8NO4P/c3-1-2-7-8(4,5)6/h1-3H2,(H2,4,5,6)/i1D2,2D2 |
| InChIKey | SUHOOTKUPISOBE-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OP(=O)(O)O)N |
