For research use only. Not for therapeutic Use.
Phox-I2 (Cat.No:I012295) is a chemical compound that functions as a potent inhibitor of NADPH oxidase, an enzyme responsible for generating reactive oxygen species (ROS). Phox-I2 has shown potential in attenuating oxidative stress and inflammation. Its inhibitory effects on NADPH oxidase make it a promising candidate for therapeutic interventions in conditions associated with excessive ROS production.
CAS Number | 353495-22-4 |
Synonyms | 3a,4,5,9b-Tetrahydro-8-nitro-4-(3-nitrophenyl)-3H-Cyclopenta[c]quinoline |
Molecular Formula | C18H15N3O4 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | 8-nitro-4-(3-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
InChI | InChI=1S/C18H15N3O4/c22-20(23)12-4-1-3-11(9-12)18-15-6-2-5-14(15)16-10-13(21(24)25)7-8-17(16)19-18/h1-5,7-10,14-15,18-19H,6H2 |
InChIKey | PADQUVZDTGNTLH-UHFFFAOYSA-N |
SMILES | C1C=CC2C1C(NC3=C2C=C(C=C3)[N+](=O)[O-])C4=CC(=CC=C4)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |