Phthalazinone pyrazole（Cat No.:R049577）is a small molecule inhibitor that targets poly(ADP-ribose) polymerase (PARP), an enzyme involved in DNA repair. By inhibiting PARP activity, Phthalazinone pyrazole interferes with the repair of single-strand DNA breaks, leading to cell death, particularly in cancer cells with deficient homologous recombination repair pathways, such as BRCA-mutant cancers. This compound is of interest in cancer therapy as it enhances the efficacy of DNA-damaging agents and is explored for its potential to treat cancers reliant on PARP for survival. Its selectivity makes it valuable in precision oncology research.
| Catalog Number | R049577 |
| CAS Number | 880487-62-7 |
| Synonyms | 4-[(5-methyl-1H-pyrazol-3-yl)amino]-2H-phenyl-1-phthalazinone |
| Molecular Formula | C18H15N5O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-phenylphthalazin-1-one |
| InChI | InChI=1S/C18H15N5O/c1-12-11-16(21-20-12)19-17-14-9-5-6-10-15(14)18(24)23(22-17)13-7-3-2-4-8-13/h2-11H,1H3,(H2,19,20,21,22) |
| InChIKey | DSDIWWSXOOXFSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=NN(C(=O)C3=CC=CC=C32)C4=CC=CC=C4 |
| Reference | 1.Moore, A.S.,Blagg, J.,Linardopoulos, S., et al. Aurora kinase inhibitors: Novel small molecules with promising activity in acute myeloid and Philadelphia-positive leukemias. Leukemia 24(4), 671-678 (2010). |
