Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> Phthalic Acid Anhydride-d4
For research use only. Not for therapeutic Use.
Phthalic Acid Anhydride-d4 is a deuterated form of phthalic acid anhydride, where four hydrogen atoms are replaced with deuterium. This compound is widely used in analytical chemistry and drug development for precise quantification and identification in mass spectrometry due to its distinct isotopic signature. It serves as a valuable internal standard in metabolic studies, helping researchers track the transformation and behavior of phthalic acid derivatives in biological systems. Its applications extend to studying chemical reactions, validating synthesis processes, and investigating the metabolism of phthalic acid-based compounds in pharmaceutical and organic chemistry research.
CAS Number | 75935-32-9 |
Synonyms | 1,2-Benzenedicarboxylic Anhydride-d4; 1,3-Phthalandione-d4; 2-Benzofuran-1,3-dione-d4; Araldite HT 901-d4; ESEN-d4; HT 901-d4; NSC 10431-d4; Phthalandione-d4; Phthalanhydride-d4; Phthalic acid anhydride-d4; Retarder AK-d4; Retarder B-C-d4; Retarder E |
Molecular Formula | C8H4O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,5,6,7-tetradeuterio-2-benzofuran-1,3-dione |
InChI | InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H/i1D,2D,3D,4D |
InChIKey | LGRFSURHDFAFJT-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=O)OC2=O)[2H])[2H] |