For research use only. Not for therapeutic Use.
Phthalic Acid Cyclohexyl Isobutyl Ester is a phthalate ester used in materials science and chemical research. It serves as a plasticizer, enhancing the flexibility and durability of polymers. This compound is essential for studying the properties of plasticized materials and developing advanced polymer formulations, ensuring precise and reliable results in industrial and scientific applications.
| CAS Number | 5334-09-8 |
| Synonyms | NSC 2387; NSC 67410; 1,2-Benzenedicarboxylic Acid, Cyclohexyl 2-Methylpropyl Ester; 1,2-Benzenedicarboxylic Acid, 1-Cyclohexyl 2-(2-Methylpropyl) Ester; Phthalic Acid Cyclohexyl Isobutyl Ester; |
| Molecular Formula | C18H24O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-O-cyclohexyl 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C18H24O4/c1-13(2)12-21-17(19)15-10-6-7-11-16(15)18(20)22-14-8-4-3-5-9-14/h6-7,10-11,13-14H,3-5,8-9,12H2,1-2H3 |
| InChIKey | ACVHLWLOORYJEE-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC=CC=C1C(=O)OC2CCCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
