For research use only. Not for therapeutic Use.
Phthalic acid disodium salt(Cat No.:M086743), is a chemical compound commonly referred to as disodium phthalate. It is a sodium salt of phthalic acid and is used in various applications, including as a pH regulator and buffering agent in the food and pharmaceutical industries. Disodium phthalate helps control the acidity and alkalinity of products, ensuring stable pH levels. Additionally, it is employed as a chelating agent in analytical chemistry and as a component in some cosmetics and personal care products. Its versatility in maintaining pH balance and its chelating properties make it valuable in different industrial and consumer applications.
Catalog Number | M086743 |
CAS Number | 15968-01-1 |
Molecular Formula | C8H4Na2O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | disodium;phthalate |
InChI | InChI=1S/C8H6O4.2Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
InChIKey | HQWKKEIVHQXCPI-UHFFFAOYSA-L |
SMILES | C1=CC=C(C(=C1)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |