Phthalic Acid (Phenyl-13C6, D4)（Cat No.:R024735） is a doubly labeled derivative of phthalic acid, where the phenyl ring is enriched with six carbon-13 atoms and four deuterium atoms. This isotopic labeling greatly enhances its utility in environmental and materials science research, particularly in studies of polymer degradation and the environmental fate of phthalates. The increased stability and distinct isotopic signature allow for precise tracking and quantification in complex matrices using NMR spectroscopy and mass spectrometry. This compound is crucial for researchers aiming to understand the impact of industrial chemicals on the environment and human health.
| Catalog Number | R024735 |
| CAS Number | 88-99-3 |
| Synonyms | 1,2-Benzenedicarboxylic Acid; M 2; NSC 5348; Sunftal 20; o-Benzenedicarboxylic Acid; o-Carboxybenzoic Acid; o-Dicarboxybenzene; |
| Molecular Formula | C₂¹³C₆H₂D₄O₄ |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | phthalic acid |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | XNGIFLGASWRNHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)O |
