For research use only. Not for therapeutic Use.
Phthalylsulfathiazole（Cat No.:I005150）is a sulfonamide compound used primarily for its antimicrobial properties, particularly in treating gastrointestinal infections. It is a prodrug, which, once metabolized, becomes active against a range of Gram-positive and Gram-negative bacteria. Its mechanism of action involves inhibiting bacterial folic acid synthesis by targeting dihydropteroate synthetase. This inhibition disrupts bacterial cell metabolism, leading to cell death. Phthalylsulfathiazole is commonly used in veterinary medicine and has applications in treating infections like enteritis and colitis in animals. Its use in human medicine is limited due to potential adverse effects.
| Catalog Number | I005150 |
| CAS Number | 85-73-4 |
| Molecular Formula | C17H13N3O5S2 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO: ≥ 40 mg/mL |
| Storage | Store at RT |
| IUPAC Name | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzoic acid |
| InChI | InChI=1S/C17H13N3O5S2/c21-15(13-3-1-2-4-14(13)16(22)23)19-11-5-7-12(8-6-11)27(24,25)20-17-18-9-10-26-17/h1-10H,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | PBMSWVPMRUJMPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC3=NC=CS3)C(=O)O |
| Reference | <p style=/line-height:25px/> |
