For research use only. Not for therapeutic Use.
Phytol（Cat No.:M069390）is a diterpene alcohol derived from the chlorophyll molecule, widely found in plants and algae. It serves as a precursor for the biosynthesis of essential vitamins, such as vitamin E (tocopherols) and vitamin K1. Phytol exhibits various bioactive properties, including antioxidant, anti-inflammatory, and antimicrobial effects, making it a valuable compound in pharmaceutical and cosmetic formulations. Additionally, it is used in the production of synthetic intermediates and fragrances. Its natural origin and versatile applications make Phytol an important compound in biochemical and industrial research.
| Catalog Number | M069390 |
| CAS Number | 150-86-7 |
| Synonyms | 3,7R,11R,15-tetramethyl-2E-hexadecen-1-ol |
| Molecular Formula | C20H40O |
| Purity | ≥95% |
| Target | RAR/RXR |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol |
| InChI | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | BOTWFXYSPFMFNR-PYDDKJGSSA-N |
| SMILES | C[C@@H](CCC[C@@H](C)CCC/C(=C/CO)/C)CCCC(C)C |
