For research use only. Not for therapeutic Use.
PI-828（Cat No.:I010637）is a dual inhibitor targeting both phosphoinositide 3-kinase (PI3K) and casein kinase 2 (CK2). It demonstrates inhibitory activity against p110α, the catalytic subunit of PI3K, with an IC50 value of 173 nM. Additionally, PI-828 inhibits CK2 and its α2 subunit with IC50 values of 149 nM and 1127 nM, respectively. By targeting these key enzymes, PI-828 has the potential to modulate signaling pathways involved in various cellular processes and may serve as a valuable tool in research and therapeutic development.
| Catalog Number | I010637 |
| CAS Number | 942289-87-4 |
| Synonyms | 2-(4-Morpholinyl)-8-(4-aminopheny)l-4H-1-benzopyran-4-one |
| Molecular Formula | C19H18N2O3 |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at +4°C |
| IUPAC Name | 8-(4-aminophenyl)-2-morpholin-4-ylchromen-4-one |
| InChI | InChI=1S/C19H18N2O3/c20-14-6-4-13(5-7-14)15-2-1-3-16-17(22)12-18(24-19(15)16)21-8-10-23-11-9-21/h1-7,12H,8-11,20H2 |
| InChIKey | WUKMIBOGGXMBAC-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)N |
