For research use only. Not for therapeutic Use.
Picaridin(Cat No.:R007881)is a highly effective insect repellent widely used to protect against mosquito, tick, and fly bites. It works by masking human scent, making it difficult for insects to detect and target. Picaridin is known for its long-lasting protection, low odor, and non-greasy feel, making it a popular alternative to DEET. Safe for use on skin and clothing, it is suitable for all age groups. Its efficacy in preventing bites also helps reduce the risk of vector-borne diseases like malaria, dengue, and Lyme disease, making it essential for public health.
CAS Number | 119515-38-7 |
Synonyms | 2-(2-Hydroxyethyl)-1-piperidinecarboxylic Acid 1-Methyl-propyl Ester; Icaridin; KBR 3023; Bayrepel; |
Molecular Formula | C12H23NO3 |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | butan-2-yl 2-(2-hydroxyethyl)piperidine-1-carboxylate |
InChI | InChI=1S/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3 |
InChIKey | QLHULAHOXSSASE-UHFFFAOYSA-N |
SMILES | CCC(C)OC(=O)N1CCCCC1CCO |