For research use only. Not for therapeutic Use.
Piceatannol (Cat No.:I000099) is a naturally occurring stilbenoid compound found in various plants, including grapes, passion fruit, and peanuts. It exhibits diverse pharmacological activities by targeting specific molecular pathways. Piceatannol has been shown to act as a potent inhibitor of the enzyme tyrosine kinase, thereby blocking signaling pathways involved in cell growth and proliferation. This makes it a potential candidate for cancer treatment, particularly in inhibiting the growth of cancer cells. Additionally, piceatannol demonstrates anti-inflammatory effects by inhibiting various inflammatory mediators. Its antioxidant activity helps protect against oxidative stress-related damage. Piceatannol’s multifaceted pharmacological properties and target-specific actions make it a promising compound for further research and therapeutic applications.
Catalog Number | I000099 |
CAS Number | 10083-24-6 |
Synonyms | 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
Molecular Formula | C14H12O4 |
Purity | ≥95% |
Target | Autophagy |
Solubility | Soluble in DMSO to 100 mM and in ethanol to 100 mM |
Storage | 3 years -20C powder |
IUPAC Name | 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1+ |
InChIKey | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=CC(=C2)O)O)O)O |
Reference | <p style=”/line-height:25px/”> |