For research use only. Not for therapeutic Use.
| Catalog Number | R001405 |
| CAS Number | 1918-02-1 |
| Molecular Formula | C6H3Cl3N2O2 |
| Purity | ≥95% |
| Storage | <30°C |
| IUPAC Name | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid |
| InChI | InChI=1S/C6H3Cl3N2O2/c7-1-3(10)2(8)5(9)11-4(1)6(12)13/h(H2,10,11)(H,12,13) |
| InChIKey | NQQVFXUMIDALNH-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
| Reference | Zheng H.G. and Hall J.C., 2001, Understanding auxinic herbicide resistance in wild mustard: physiological, biochemical, and molecular genetic approaches. Weed Science, 49:276-281. 2001</span></p> |
