For research use only. Not for therapeutic Use.
Picolinic Acid is a naturally occurring organic acid and a derivative of pyridine. It plays a crucial role in the metabolism of tryptophan and is involved in the regulation of metal ion homeostasis, particularly zinc. Picolinic Acid has potential applications in medicine and biochemistry due to its ability to chelate metal ions, which is useful in the treatment of metal poisoning. It is also studied for its neuroprotective and antioxidant properties, with potential implications for neurological disorders.
CAS Number | 98-98-6 |
Synonyms | 2-Pyridinecarboxylic Acid; 2-Carboxypyridine; 2-Pyridylcarboxylic Acid; NSC 171; PCL 016; o-Pyridinecarboxylic Acid; α-Pyridinecarboxylic Acid; |
Molecular Formula | C6H5NO2 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Store at RT |
IUPAC Name | pyridine-2-carboxylic acid |
InChI | InChI=1S/C6H5NO2/c8-6(9)5-3-1-2-4-7-5/h1-4H,(H,8,9) |
InChIKey | SIOXPEMLGUPBBT-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C(=O)O |