For research use only. Not for therapeutic Use.
Picrasin B is a natural quassinoid compound derived from plants, used in pharmaceutical and biochemical research. Known for its potential antimalarial, anticancer, and anti-inflammatory properties, it is essential for studying the biological activities and therapeutic applications of natural products. This compound aids in understanding the mechanisms of action of quassinoids and developing novel treatments. Researchers rely on Picrasin B for precise and reliable results in advanced natural product chemistry and drug discovery, contributing significantly to innovations in health and medicine.
| Catalog Number | R012638 |
| CAS Number | 26121-56-2 |
| Molecular Formula | C21H28O6 |
| Purity | ≥95% |
| Target | Plants |
| Storage | Store at -20°C |
| InChI | InChI=1S/C21H28O6/c1-9-6-13(22)19(25)21(4)11(9)7-14-20(3)12(8-15(23)27-14)10(2)17(26-5)16(24)18(20)21/h9,11-14,18,22H,6-8H2,1-5H3/t9-,11+,12+,13+,14-,18+,20-,21+/m1/s1 |
| InChIKey | GESOKLRVLMVNMO-WCAPFRRUSA-N |
| SMILES | CC1CC(C(=O)C2(C1CC3C4(C2C(=O)C(=C(C4CC(=O)O3)C)OC)C)C)O |
