Picrocrocin（Cat No.:R022933）is a key compound found in saffron, responsible for its distinctive bitter taste and aroma. It is a monoterpene glycoside and a significant marker for saffron quality. In addition to its culinary uses, Picrocrocin has shown potential in medicinal applications due to its antioxidant, anti-inflammatory, and neuroprotective properties. It plays a crucial role in traditional medicine and ongoing research into natural remedies. High-purity Picrocrocin is essential for researchers exploring its diverse therapeutic benefits and for ensuring the authenticity and quality of saffron products.
| Catalog Number | R022933 |
| CAS Number | 138-55-6 |
| Synonyms | (R)-4-(β-D-Glucopyranosyloxy)-2,6,6-trimethyl-1-cyclohexene-1-carboxaldehyde; Picrocrocin; Picrocrocine; Saffron-bitter |
| Molecular Formula | C16H26O7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4R)-2,6,6-trimethyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexene-1-carbaldehyde |
| InChI | InChI=1S/C16H26O7/c1-8-4-9(5-16(2,3)10(8)6-17)22-15-14(21)13(20)12(19)11(7-18)23-15/h6,9,11-15,18-21H,4-5,7H2,1-3H3/t9-,11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | WMHJCSAICLADIN-WYWSWGBSSA-N |
| SMILES | CC1=C(C(CC(C1)OC2C(C(C(C(O2)CO)O)O)O)(C)C)C=O |
