For research use only. Not for therapeutic Use.
Picropodophyllone, an aryltetralin lignan, is isolated from leaves of Podophyllum hexandrum, and has antifungal activities[1][2].
| Catalog Number | I044880 |
| CAS Number | 477-48-5 |
| Synonyms | (5aR,8aS,9R)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-[2]benzofuro[5,6-f][1,3]benzodioxole-5,8-dione |
| Molecular Formula | C22H20O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18+,19+/m0/s1 |
| InChIKey | ISCQYPPCSYRZOT-MJXNMMHHSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2C3C(COC3=O)C(=O)C4=CC5=C(C=C24)OCO5 |
| Reference | [1]. Yin ML, et, al. [Chemical constituents of Dysosma aurantiocaulis (H.-M.) Hu and Dysosma pleianthum Woods]. Zhongguo Zhong Yao Za Zhi. 1989 Jul; 14(7): 420-1, 447. [2]. Atta-ur-Rahman, et, al. Antifungal aryltetralin lignans from leaves of Podophyllum hexandrum. Phytochemistry. 1995 Sep; 40(2): 427-431. |
