For research use only. Not for therapeutic Use.
Picropodophyllotoxin（Cat No.:I003667）is a natural lignan compound derived from the roots of Podophyllum species. It is a potent inhibitor of microtubule assembly, which disrupts mitosis and inhibits cell division, making it valuable in cancer research. Picropodophyllotoxin is structurally similar to podophyllotoxin but differs in its stereochemistry. Its ability to interfere with microtubule dynamics has made it a key molecule in the development of anticancer drugs, particularly in the study of chemotherapeutic agents targeting rapidly proliferating cancer cells.
| Catalog Number | I003667 |
| CAS Number | 477-47-4 |
| Synonyms | (5R,5aR,8aS,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| Molecular Formula | C₂₂H₂₂O₈ |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | in DMSO > 10 mM |
| Storage | Store at -20°C |
| IC50 | 1 nM(IGF1R autophosphorylation) |
| IUPAC Name | (5R,5aR,8aS,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| InChI | InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19+,20-/m0/s1 |
| InChIKey | YJGVMLPVUAXIQN-HAEOHBJNSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@H]3[C@H](COC3=O)[C@H](C4=CC5=C(C=C24)OCO5)O |
