For research use only. Not for therapeutic Use.
Pidotimod（Cat No.:I000831）is an immunostimulant compound with immunomodulatory properties. It is a synthetic dipeptide that has been found to enhance the immune response. Pidotimod is known to stimulate the production of certain immune cells and increase the release of cytokines involved in immune regulation. Additionally, it has been shown to increase the concentration of salivary immunoglobulin A (IgA) antibodies targeted against bacteria. These properties suggest that pidotimod may have potential applications in boosting immune function and promoting defense against bacterial infections.
| Catalog Number | I000831 |
| CAS Number | 121808-62-6 |
| Synonyms | PGT/1A |
| Molecular Formula | C9H12N2O4S |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO:36mg/mL |
| Storage | 2-8°C |
| IUPAC Name | (4R)-3-[(2S)-5-oxopyrrolidine-2-carbonyl]-1,3-thiazolidine-4-carboxylic acid |
| InChI | InChI=1S/C9H12N2O4S/c12-7-2-1-5(10-7)8(13)11-4-16-3-6(11)9(14)15/h5-6H,1-4H2,(H,10,12)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | UUTKICFRNVKFRG-WDSKDSINSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N2CSC[C@H]2C(=O)O |
