For research use only. Not for therapeutic Use.
Pifithrin-α, Cyclic, hydrobromide（Cat No.:I003832）is a chemical compound used primarily in research related to cellular stress responses and the regulation of p53, a tumor suppressor protein. It is a p53 inhibitor, known for its ability to block the activation of p53 in response to DNA damage or cellular stress. By inhibiting p53, Pifithrin-α may help in studies of cell survival, apoptosis, and cancer biology. Additionally, it is explored for its potential to mitigate side effects of cancer therapies that induce p53-mediated cell death. Its effects on cancer treatment and cellular function are still under investigation.
| Catalog Number | I003832 |
| CAS Number | 511296-88-1 |
| Synonyms | 2-(4-methylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole;hydrobromide |
| Molecular Formula | C₁₆H₁₆N₂S ∙ HBr |
| Purity | ≥95% |
| Target | MDM-2/p53 |
| Solubility | DMSO: ≤ 26 mg/mL |
| Storage | Desiccate at RT |
| IC50 | 23 uM(IGROV-1 cell line) |
| IUPAC Name | 2-(4-methylphenyl)-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole;hydrobromide |
| InChI | InChI=1S/C16H16N2S.BrH/c1-11-6-8-12(9-7-11)13-10-18-14-4-2-3-5-15(14)19-16(18)17-13;/h6-10H,2-5H2,1H3;1H |
| InChIKey | SGNCOAOESGSEOP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN3C4=C(CCCC4)SC3=N2.Br |
