For research use only. Not for therapeutic Use.
PIK-108 is a selective inhibitor of phosphoinositide 3-kinase (PI3K), specifically targeting the PI3Kγ isoform. PI3Kγ plays a crucial role in cell signaling pathways related to cell growth, proliferation, survival, and inflammation. PIK-108 is primarily used in cancer research and immunology to study the PI3K/AKT/mTOR signaling pathway, which is often dysregulated in cancer and inflammatory diseases. By inhibiting PI3Kγ, PIK-108 helps researchers explore its therapeutic potential in treating cancer, immune disorders, and inflammatory conditions, offering insights into developing targeted therapies that disrupt aberrant PI3K signaling.
Catalog Number | I008759 |
CAS Number | 901398-68-3 |
Synonyms | PIK-108; PIK 108; PIK108.;(S)-6-methyl-2-morpholino-8-(1-(phenylamino)ethyl)-4H-chromen-4-one |
Molecular Formula | C22H24N2O3 |
Purity | ≥95% |
Target | PI3K |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
InChI | InChI=1S/C22H24N2O3/c1-15-12-18(16(2)23-17-6-4-3-5-7-17)22-19(13-15)20(25)14-21(27-22)24-8-10-26-11-9-24/h3-7,12-14,16,23H,8-11H2,1-2H3/t16-/m0/s1 |
InChIKey | VRCXIJAYLCUSHC-INIZCTEOSA-N |
SMILES | O=C1C=C(N2CCOCC2)OC3=C1C=C(C)C=C3[C@@H](NC4=CC=CC=C4)C |