For research use only. Not for therapeutic Use.
PIK-294 (Cat.No:I005385) is a selective inhibitor of phosphoinositide 3-kinase (PI3K) p110δ isoform. It has shown promising results in preclinical studies as an anticancer agent, particularly in hematological malignancies. PIK-294 inhibits aberrant PI3K signaling, leading to cell cycle arrest and apoptosis.
| Catalog Number | I005385 |
| CAS Number | 900185-02-6 |
| Synonyms | 2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| Molecular Formula | C₂₈H₂₃N₇O₂ |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | DMSO: ≥ 40 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 10 nM(p110δ) [1] |
| IUPAC Name | 2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| InChI | InChI=1S/C28H23N7O2/c1-16-7-3-4-12-21(16)35-22(32-20-11-5-8-17(2)23(20)28(35)37)14-34-27-24(26(29)30-15-31-27)25(33-34)18-9-6-10-19(36)13-18/h3-13,15,36H,14H2,1-2H3,(H2,29,30,31) |
| InChIKey | WFSLJOPRIJSOJR-UHFFFAOYSA-N |
| SMILES | O=C1N(C2=CC=CC=C2C)C(CN3N=C(C4=CC=CC(O)=C4)C5=C(N)N=CN=C53)=NC6=C1C(C)=CC=C6 |
| Reference | <p style=/line-height:25px/> |
