For research use only. Not for therapeutic Use.
Piketoprofen (Cat.No:I012294) is a nonsteroidal anti-inflammatory drug (NSAID) belonging to the propionic acid class. It exhibits analgesic, anti-inflammatory, and antipyretic properties. Piketoprofen is commonly used to relieve pain and reduce inflammation associated with conditions such as arthritis, musculoskeletal disorders, and postoperative pain. It functions by inhibiting the synthesis of prostaglandins, thereby reducing pain and inflammation.
CAS Number | 60576-13-8 |
Synonyms | Calmatel; 2-(3-Benzoylphenyl)-N-(4-methylpyridin-2-yl)propanamide |
Molecular Formula | C22H20N2O2 |
Purity | ≥95% |
IUPAC Name | 2-(3-benzoylphenyl)-N-(4-methylpyridin-2-yl)propanamide |
InChI | InChI=1S/C22H20N2O2/c1-15-11-12-23-20(13-15)24-22(26)16(2)18-9-6-10-19(14-18)21(25)17-7-4-3-5-8-17/h3-14,16H,1-2H3,(H,23,24,26) |
InChIKey | ASFKKFRSMGBFRO-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1)NC(=O)C(C)C2=CC=CC(=C2)C(=O)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |