For research use only. Not for therapeutic Use.
PIKfyve-IN-1（Cat No.:I042817）is a selective inhibitor of PIKfyve (Phosphatidylinositol-3-Phosphate 5-Kinase), an enzyme involved in phosphoinositide metabolism and cellular processes such as membrane trafficking and endocytosis. By inhibiting PIKfyve, PIKfyve-IN-1 disrupts the production of phosphatidylinositol-3,5-bisphosphate (PI(3,5)P2), which plays a crucial role in maintaining cellular homeostasis. This compound has potential applications in treating diseases linked to dysfunctional membrane trafficking and autophagy, such as neurodegenerative disorders and certain types of cancer. PIKfyve-IN-1 represents a promising tool for further research into cellular regulation and therapeutic intervention.
| CAS Number | 2857982-26-2 |
| Synonyms | 16-[3-(dimethylamino)prop-1-ynyl]-3,5,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13(18),14,16-heptaen-4-amine |
| Molecular Formula | C20H21N5 |
| Purity | ≥95% |
| IUPAC Name | 16-[3-(dimethylamino)prop-1-ynyl]-3,5,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,13(18),14,16-heptaen-4-amine |
| InChI | InChI=1S/C20H21N5/c1-25(2)10-4-5-13-8-9-16-15(11-13)18-17(23-16)7-3-6-14-12-22-20(21)24-19(14)18/h8-9,11-12,23H,3,6-7,10H2,1-2H3,(H2,21,22,24) |
| InChIKey | DORZPJWJOBMQKC-UHFFFAOYSA-N |
| SMILES | CN(C)CC#CC1=CC2=C(C=C1)NC3=C2C4=NC(=NC=C4CCC3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
