For research use only. Not for therapeutic Use.
<p>
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Pilocarpine (CAS 92-13-7) is a cholinergic parasympathomimetic agent. It increase secretion by the exocrine glands, and produces contraction of the iris sphincter muscle and ciliary muscle (when given topically to the eyes) by mainly stimulating muscarinic receptors. It is a medication used to reduce pressure inside the eye and treat dry mouth.</span></span></span></p>
| Catalog Number | R060738 |
| CAS Number | 92-13-7 |
| Synonyms | (3S-cis)-3-Ethyldihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]-2(3H)furanone; Pilocarpine; (+)-Pilocarpine; Ocucarpine; Ocusert P 20; Ocusert Pilo; Ocusert Pilo 40; (+)-Pilocarpine; Pilocarpol; Pilokarpin; Spersacarpine; Syncarpine |
| Molecular Formula | C11H16N2O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | (3S,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one |
| InChI | InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | QCHFTSOMWOSFHM-WPRPVWTQSA-N |
| SMILES | CCC1C(COC1=O)CC2=CN=CN2C |
| Reference | <span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">1.Kass, Michael A., et al. "Compliance with topical pilocarpine treatment." <i style="font-family: Arial, sans-serif; font-size: 13px;">American journal of ophthalmology</i> 101.5 (1986): 515-523.</span></span></span> |
