For research use only. Not for therapeutic Use.
PIM447 (CAT: I000788) is a small molecule inhibitor of the PIM kinase family, which includes PIM1, PIM2, and PIM3. PIM kinases are serine/threonine protein kinases involved in various cellular processes, including cell growth, survival, and differentiation. By selectively inhibiting PIM kinases, PIM447 disrupts the signaling pathways that contribute to cancer cell proliferation and survival. It has shown promising antitumor activity in preclinical studies and is being investigated as a potential therapeutic agent for various types of cancer, including hematological malignancies and solid tumors. PIM447 may be used alone or in combination with other anticancer therapies to target PIM kinase-dependent signaling and inhibit tumor growth.
| Catalog Number | I000788 |
| CAS Number | 1210608-43-7 |
| Synonyms | PIM447; PIM 447; PIM-447 |
| Molecular Formula | C24H23F3N4O |
| Purity | ≥95% |
| Target | target: pan-PIM inhibitor |
| Solubility | DMSO ≥ 50 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | N-[4-[(1R,3S,5S)-3-amino-5-methylcyclohexyl]pyridin-3-yl]-6-(2,6-difluorophenyl)-5-fluoropyridine-2-carboxamide |
| InChI | InChI=1S/C24H23F3N4O/c1-13-9-14(11-15(28)10-13)16-7-8-29-12-21(16)31-24(32)20-6-5-19(27)23(30-20)22-17(25)3-2-4-18(22)26/h2-8,12-15H,9-11,28H2,1H3,(H,31,32)/t13-,14+,15-/m0/s1 |
| InChIKey | VRQXRVAKPDCRCI-ZNMIVQPWSA-N |
| SMILES | O=C(NC1=C([C@H]2C[C@@H](N)C[C@@H](C)C2)C=CN=C1)C3=NC(C4=C(F)C=CC=C4F)=C(F)C=C3 |
