For research use only. Not for therapeutic Use.
PIMELOYL CHLORIDE (Cat.No:M067760) is a chemical compound used in the synthesis of biologically active molecules. It serves as a versatile building block in organic chemistry, facilitating the creation of diverse compounds with potential pharmaceutical and agrochemical applications. PIMELOYL CHLORIDE is valued in medicinal chemistry research and chemical synthesis.
CAS Number | 142-79-0 |
Molecular Formula | C7H10Cl2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | heptanedioyl dichloride |
InChI | InChI=1S/C7H10Cl2O2/c8-6(10)4-2-1-3-5-7(9)11/h1-5H2 |
InChIKey | LVIMBOHJGMDKEJ-UHFFFAOYSA-N |
SMILES | C(CCC(=O)Cl)CCC(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |