For research use only. Not for therapeutic Use.
Pimpinellin（Cat No.:M070700）, a natural compound found in plants like Anethum graveolens (dill), exhibits potent antioxidant properties due to its ability to scavenge free radicals. This bioactive phytochemical belongs to the group of coumarins, known for their diverse pharmacological effects. Pimpinellin demonstrates anti-inflammatory, antimicrobial, and anticancer activities, making it a subject of interest in medicinal research. Its molecular structure enables interactions with various cellular targets, contributing to its therapeutic potential.
| Catalog Number | M070700 |
| CAS Number | 131-12-4 |
| Molecular Formula | C13H10O5 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | 5,6-dimethoxyfuro[2,3-h]chromen-2-one |
| InChI | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
| InChIKey | BQPRWZCEKZLBHL-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=CO2)C3=C1C=CC(=O)O3)OC |
