For research use only. Not for therapeutic Use.
Pinic acid, a diastereomeric mixture, is a compound derived from the oxidation of alpha-pinene, a major component of pine resin. It plays a significant role in atmospheric chemistry, particularly in the formation of secondary organic aerosols (SOAs). Research on pinic acid helps in understanding air quality and climate change, as it influences cloud formation and the Earth’s radiation balance.
| CAS Number | 28664-02-0 |
| Synonyms | 3-Carboxy-2,2-dimethyl-cyclobutaneacetic acid; NSC 2802 |
| Molecular Formula | C9H14O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid |
| InChI | InChI=1S/C9H14O4/c1-9(2)5(4-7(10)11)3-6(9)8(12)13/h5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | LEVONNIFUFSRKZ-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1C(=O)O)CC(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
